C16H18BrClO — CID 114097119
3-[(5-bromo-2-methoxyphenyl)-chloromethyl]tricyclo[3.2.1.02,4]octane (PubChem CID 114097119) has the molecular formula C16H18BrClO and a molecular weight of 341.68 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)-chloromethyl]tricyclo[3.2.1.02,4]octane.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)-chloromethyl]tricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 114097119 |
| Molecular Formula | C16H18BrClO |
| Molecular Weight | 341.68 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)-chloromethyl]tricyclo[3.2.1.02,4]octane |
| SMILES | COc1ccc(Br)cc1C(Cl)C1C2C3CCC(C3)C21 |
| InChI | InChI=1S/C16H18BrClO/c1-19-12-5-4-10(17)7-11(12)16(18)15-13-8-2-3-9(6-8)14(13)15/h4-5,7-9,13-16H,2-3,6H2,1H3 |
| InChIKey | QWVDLQSPDASNTP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|