C18H24Cl2O — CID 104546339
2-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 104546339) has the molecular formula C18H24Cl2O and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 104546339 |
| Molecular Formula | C18H24Cl2O |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[chloro-(5-chloro-2-methoxyphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | COc1ccc(Cl)cc1C(Cl)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H24Cl2O/c1-21-17-9-8-15(19)11-16(17)18(20)14-7-6-12-4-2-3-5-13(12)10-14/h8-9,11-14,18H,2-7,10H2,1H3 |
| InChIKey | XKKZITPWKYTENE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|