C15H18Br2O — CID 81473785
2-bicyclo[2.2.1]heptanyl-(2,5-dibromo-4-methylphenyl)methanol (PubChem CID 81473785) has the molecular formula C15H18Br2O and a molecular weight of 374.12 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-(2,5-dibromo-4-methylphenyl)methanol.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-(2,5-dibromo-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 81473785 |
| Molecular Formula | C15H18Br2O |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-(2,5-dibromo-4-methylphenyl)methanol |
| SMILES | Cc1cc(Br)c(C(O)C2CC3CCC2C3)cc1Br |
| InChI | InChI=1S/C15H18Br2O/c1-8-4-14(17)12(7-13(8)16)15(18)11-6-9-2-3-10(11)5-9/h4,7,9-11,15,18H,2-3,5-6H2,1H3 |
| InChIKey | LPORGFGPSNGRRY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |