C13H16Br2O2 — CID 81474176
(2,5-dibromo-4-methylphenyl)-(oxan-2-yl)methanol (PubChem CID 81474176) has the molecular formula C13H16Br2O2 and a molecular weight of 364.08 g/mol. Its IUPAC name is (2,5-dibromo-4-methylphenyl)-(oxan-2-yl)methanol.
| Compound Name | (2,5-dibromo-4-methylphenyl)-(oxan-2-yl)methanol |
|---|---|
| PubChem CID | 81474176 |
| Molecular Formula | C13H16Br2O2 |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | (2,5-dibromo-4-methylphenyl)-(oxan-2-yl)methanol |
| SMILES | Cc1cc(Br)c(C(O)C2CCCCO2)cc1Br |
| InChI | InChI=1S/C13H16Br2O2/c1-8-6-11(15)9(7-10(8)14)13(16)12-4-2-3-5-17-12/h6-7,12-13,16H,2-5H2,1H3 |
| InChIKey | MLFDNWJDYVXHKC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |