C14H19FO2 — CID 65296637
(4-fluoro-3,5-dimethylphenyl)-(oxan-2-yl)methanol (PubChem CID 65296637) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethylphenyl)-(oxan-2-yl)methanol.
| Compound Name | (4-fluoro-3,5-dimethylphenyl)-(oxan-2-yl)methanol |
|---|---|
| PubChem CID | 65296637 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (4-fluoro-3,5-dimethylphenyl)-(oxan-2-yl)methanol |
| SMILES | Cc1cc(C(O)C2CCCCO2)cc(C)c1F |
| InChI | InChI=1S/C14H19FO2/c1-9-7-11(8-10(2)13(9)15)14(16)12-5-3-4-6-17-12/h7-8,12,14,16H,3-6H2,1-2H3 |
| InChIKey | USZAQWYRAKWJQF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |