C13H18O2 — CID 65331478
(3,5-dimethylphenyl)-(oxolan-2-yl)methanol (PubChem CID 65331478) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(oxolan-2-yl)methanol.
| Compound Name | (3,5-dimethylphenyl)-(oxolan-2-yl)methanol |
|---|---|
| PubChem CID | 65331478 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3,5-dimethylphenyl)-(oxolan-2-yl)methanol |
| SMILES | Cc1cc(C)cc(C(O)C2CCCO2)c1 |
| InChI | InChI=1S/C13H18O2/c1-9-6-10(2)8-11(7-9)13(14)12-4-3-5-15-12/h6-8,12-14H,3-5H2,1-2H3 |
| InChIKey | ZJNBZTXVIMEKKG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |