C12H13BrF2O3 — CID 55119810
2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-1,4-dioxane (PubChem CID 55119810) has the molecular formula C12H13BrF2O3 and a molecular weight of 323.13 g/mol. Its IUPAC name is 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-1,4-dioxane.
| Compound Name | 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 55119810 |
| Molecular Formula | C12H13BrF2O3 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]-1,4-dioxane |
| SMILES | COc1cc(F)c(C(Br)C2COCCO2)c(F)c1 |
| InChI | InChI=1S/C12H13BrF2O3/c1-16-7-4-8(14)11(9(15)5-7)12(13)10-6-17-2-3-18-10/h4-5,10,12H,2-3,6H2,1H3 |
| InChIKey | GNIGTWGWMWSLGM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|