C13H18FNO3 — CID 65351095
1-(1,4-dioxan-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 65351095) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 65351095 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-2-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CC(N)C2COCCO2)cc1F |
| InChI | InChI=1S/C13H18FNO3/c1-16-12-3-2-9(6-10(12)14)7-11(15)13-8-17-4-5-18-13/h2-3,6,11,13H,4-5,7-8,15H2,1H3 |
| InChIKey | ABEBQRMHFRFAPT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |