C13H18BrNO3 — CID 65352974
2-(3-bromo-4-methoxyphenyl)-1-(1,4-dioxan-2-yl)ethanamine (PubChem CID 65352974) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(1,4-dioxan-2-yl)ethanamine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(1,4-dioxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 65352974 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(1,4-dioxan-2-yl)ethanamine |
| SMILES | COc1ccc(CC(N)C2COCCO2)cc1Br |
| InChI | InChI=1S/C13H18BrNO3/c1-16-12-3-2-9(6-10(12)14)7-11(15)13-8-17-4-5-18-13/h2-3,6,11,13H,4-5,7-8,15H2,1H3 |
| InChIKey | QOAJQRBRIXUWSV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |