C12H14BrF2NO2 — CID 114167013
2-(3-bromo-2,6-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine (PubChem CID 114167013) has the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 114167013 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
| SMILES | NC(Cc1c(F)ccc(Br)c1F)C1COCCO1 |
| InChI | InChI=1S/C12H14BrF2NO2/c13-8-1-2-9(14)7(12(8)15)5-10(16)11-6-17-3-4-18-11/h1-2,10-11H,3-6,16H2 |
| InChIKey | KVHCAVSLMUCCLI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|