C15H21BrF2N2O — CID 106267860
1-(3-bromo-2,6-difluorophenyl)-3-methyl-3-morpholin-4-ylbutan-2-amine (PubChem CID 106267860) has the molecular formula C15H21BrF2N2O and a molecular weight of 363.25 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-methyl-3-morpholin-4-ylbutan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-methyl-3-morpholin-4-ylbutan-2-amine |
|---|---|
| PubChem CID | 106267860 |
| Molecular Formula | C15H21BrF2N2O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-methyl-3-morpholin-4-ylbutan-2-amine |
| SMILES | CC(C)(C(N)Cc1c(F)ccc(Br)c1F)N1CCOCC1 |
| InChI | InChI=1S/C15H21BrF2N2O/c1-15(2,20-5-7-21-8-6-20)13(19)9-10-12(17)4-3-11(16)14(10)18/h3-4,13H,5-9,19H2,1-2H3 |
| InChIKey | LZQFNNFQDZWGAC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|