C14H16BrF2N — CID 106273642
1-(3-bicyclo[3.1.0]hexanyl)-2-(3-bromo-2,6-difluorophenyl)ethanamine (PubChem CID 106273642) has the molecular formula C14H16BrF2N and a molecular weight of 316.19 g/mol. Its IUPAC name is 1-(3-bicyclo[3.1.0]hexanyl)-2-(3-bromo-2,6-difluorophenyl)ethanamine.
| Compound Name | 1-(3-bicyclo[3.1.0]hexanyl)-2-(3-bromo-2,6-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 106273642 |
| Molecular Formula | C14H16BrF2N |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-(3-bicyclo[3.1.0]hexanyl)-2-(3-bromo-2,6-difluorophenyl)ethanamine |
| SMILES | NC(Cc1c(F)ccc(Br)c1F)C1CC2CC2C1 |
| InChI | InChI=1S/C14H16BrF2N/c15-11-1-2-12(16)10(14(11)17)6-13(18)9-4-7-3-8(7)5-9/h1-2,7-9,13H,3-6,18H2 |
| InChIKey | NSPKMEXJSFMMLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|