C14H10Br2F2IN — CID 106273986
2-(3-bromo-2,6-difluorophenyl)-1-(5-bromo-2-iodophenyl)ethanamine (PubChem CID 106273986) has the molecular formula C14H10Br2F2IN and a molecular weight of 516.95 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(5-bromo-2-iodophenyl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5-bromo-2-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 106273986 |
| Molecular Formula | C14H10Br2F2IN |
| Molecular Weight | 516.95 g/mol |
| Exact Mass | 514.82 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5-bromo-2-iodophenyl)ethanamine |
| SMILES | NC(Cc1c(F)ccc(Br)c1F)c1cc(Br)ccc1I |
| InChI | InChI=1S/C14H10Br2F2IN/c15-7-1-4-12(19)9(5-7)13(20)6-8-11(17)3-2-10(16)14(8)18/h1-5,13H,6,20H2 |
| InChIKey | VCZAJXADWIVYRF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|