C14H11Br2F2N — CID 114894635
2-(2-bromo-5-fluorophenyl)-1-(5-bromo-2-fluorophenyl)ethanamine (PubChem CID 114894635) has the molecular formula C14H11Br2F2N and a molecular weight of 391.05 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(5-bromo-2-fluorophenyl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(5-bromo-2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 114894635 |
| Molecular Formula | C14H11Br2F2N |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(5-bromo-2-fluorophenyl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1Br)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H11Br2F2N/c15-9-1-4-13(18)11(7-9)14(19)6-8-5-10(17)2-3-12(8)16/h1-5,7,14H,6,19H2 |
| InChIKey | KSWJCMIDHNXJLX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |