C14H10BrF4N — CID 115843812
2-(2-bromo-5-fluorophenyl)-1-(2,4,6-trifluorophenyl)ethanamine (PubChem CID 115843812) has the molecular formula C14H10BrF4N and a molecular weight of 348.14 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(2,4,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 115843812 |
| Molecular Formula | C14H10BrF4N |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1Br)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H10BrF4N/c15-10-2-1-8(16)3-7(10)4-13(20)14-11(18)5-9(17)6-12(14)19/h1-3,5-6,13H,4,20H2 |
| InChIKey | IJUXXDCDOSOJKV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |