C14H11BrF3N — CID 43198672
2-(4-bromophenyl)-1-(2,4,6-trifluorophenyl)ethanamine (PubChem CID 43198672) has the molecular formula C14H11BrF3N and a molecular weight of 330.15 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(2,4,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(4-bromophenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43198672 |
| Molecular Formula | C14H11BrF3N |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-(4-bromophenyl)-1-(2,4,6-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H11BrF3N/c15-9-3-1-8(2-4-9)5-13(19)14-11(17)6-10(16)7-12(14)18/h1-4,6-7,13H,5,19H2 |
| InChIKey | XCJSRIWRLYDSSF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |