C16H16BrF2N — CID 115803938
1-(4-bromo-2,6-difluorophenyl)-2-(4-ethylphenyl)ethanamine (PubChem CID 115803938) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-(4-ethylphenyl)ethanamine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-(4-ethylphenyl)ethanamine |
|---|---|
| PubChem CID | 115803938 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-(4-ethylphenyl)ethanamine |
| SMILES | CCc1ccc(CC(N)c2c(F)cc(Br)cc2F)cc1 |
| InChI | InChI=1S/C16H16BrF2N/c1-2-10-3-5-11(6-4-10)7-15(20)16-13(18)8-12(17)9-14(16)19/h3-6,8-9,15H,2,7,20H2,1H3 |
| InChIKey | MXIMQMMIQHZWBD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |