C15H15BrF2N2 — CID 105014806
1-(4-bromo-2,6-difluorophenyl)-2-(5-ethyl-2-pyridinyl)ethanamine (PubChem CID 105014806) has the molecular formula C15H15BrF2N2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-(5-ethyl-2-pyridinyl)ethanamine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-(5-ethyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 105014806 |
| Molecular Formula | C15H15BrF2N2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-(5-ethyl-2-pyridinyl)ethanamine |
| SMILES | CCc1ccc(CC(N)c2c(F)cc(Br)cc2F)nc1 |
| InChI | InChI=1S/C15H15BrF2N2/c1-2-9-3-4-11(20-8-9)7-14(19)15-12(17)5-10(16)6-13(15)18/h3-6,8,14H,2,7,19H2,1H3 |
| InChIKey | IPGAZDYEQGRBLH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |