C12H10F3NO — CID 105030125
2-(furan-3-yl)-1-(2,4,6-trifluorophenyl)ethanamine (PubChem CID 105030125) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-(2,4,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(furan-3-yl)-1-(2,4,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105030125 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(furan-3-yl)-1-(2,4,6-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1ccoc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H10F3NO/c13-8-4-9(14)12(10(15)5-8)11(16)3-7-1-2-17-6-7/h1-2,4-6,11H,3,16H2 |
| InChIKey | GOXCBXQBEFUNDU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |