C13H10BrF3N2 — CID 105036929
2-(5-bromo-3-pyridinyl)-1-(2,4,6-trifluorophenyl)ethanamine (PubChem CID 105036929) has the molecular formula C13H10BrF3N2 and a molecular weight of 331.14 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1-(2,4,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1-(2,4,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105036929 |
| Molecular Formula | C13H10BrF3N2 |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1-(2,4,6-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1cncc(Br)c1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H10BrF3N2/c14-8-1-7(5-19-6-8)2-12(18)13-10(16)3-9(15)4-11(13)17/h1,3-6,12H,2,18H2 |
| InChIKey | GHOHJHWOJQIIIK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |