C13H11F4NO — CID 83183260
1-[2-fluoro-5-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanamine (PubChem CID 83183260) has the molecular formula C13H11F4NO and a molecular weight of 273.23 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanamine.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 83183260 |
| Molecular Formula | C13H11F4NO |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-2-(furan-3-yl)ethanamine |
| SMILES | NC(Cc1ccoc1)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H11F4NO/c14-11-2-1-9(13(15,16)17)6-10(11)12(18)5-8-3-4-19-7-8/h1-4,6-7,12H,5,18H2 |
| InChIKey | GGSMIMNOMIHHIX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |