C12H15BrO4 — CID 62803125
(5-bromo-2-methoxyphenyl)-(1,4-dioxan-2-yl)methanol (PubChem CID 62803125) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)-(1,4-dioxan-2-yl)methanol.
| Compound Name | (5-bromo-2-methoxyphenyl)-(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 62803125 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)-(1,4-dioxan-2-yl)methanol |
| SMILES | COc1ccc(Br)cc1C(O)C1COCCO1 |
| InChI | InChI=1S/C12H15BrO4/c1-15-10-3-2-8(13)6-9(10)12(14)11-7-16-4-5-17-11/h2-3,6,11-12,14H,4-5,7H2,1H3 |
| InChIKey | GTBXPWNIMICIPE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |