C12H15FO4 — CID 113342471
1,4-dioxan-2-yl-(2-fluoro-3-methoxyphenyl)methanol (PubChem CID 113342471) has the molecular formula C12H15FO4 and a molecular weight of 242.25 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(2-fluoro-3-methoxyphenyl)methanol.
| Compound Name | 1,4-dioxan-2-yl-(2-fluoro-3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 113342471 |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1,4-dioxan-2-yl-(2-fluoro-3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)C2COCCO2)c1F |
| InChI | InChI=1S/C12H15FO4/c1-15-9-4-2-3-8(11(9)13)12(14)10-7-16-5-6-17-10/h2-4,10,12,14H,5-7H2,1H3 |
| InChIKey | RYGRGKDOEJFRQD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |