C14H20FNO3 — CID 55120194
N-[1,4-dioxan-2-yl-(5-fluoro-2-methoxyphenyl)methyl]ethanamine (PubChem CID 55120194) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[1,4-dioxan-2-yl-(5-fluoro-2-methoxyphenyl)methyl]ethanamine.
| Compound Name | N-[1,4-dioxan-2-yl-(5-fluoro-2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 55120194 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[1,4-dioxan-2-yl-(5-fluoro-2-methoxyphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)ccc1OC)C1COCCO1 |
| InChI | InChI=1S/C14H20FNO3/c1-3-16-14(13-9-18-6-7-19-13)11-8-10(15)4-5-12(11)17-2/h4-5,8,13-14,16H,3,6-7,9H2,1-2H3 |
| InChIKey | UGRXKZARPMKRSC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |