C13H16ClF2NO2 — CID 107476476
N-[(2-chloro-4,5-difluorophenyl)-(1,4-dioxan-2-yl)methyl]ethanamine (PubChem CID 107476476) has the molecular formula C13H16ClF2NO2 and a molecular weight of 291.73 g/mol. Its IUPAC name is N-[(2-chloro-4,5-difluorophenyl)-(1,4-dioxan-2-yl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-4,5-difluorophenyl)-(1,4-dioxan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107476476 |
| Molecular Formula | C13H16ClF2NO2 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[(2-chloro-4,5-difluorophenyl)-(1,4-dioxan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)c(F)cc1Cl)C1COCCO1 |
| InChI | InChI=1S/C13H16ClF2NO2/c1-2-17-13(12-7-18-3-4-19-12)8-5-10(15)11(16)6-9(8)14/h5-6,12-13,17H,2-4,7H2,1H3 |
| InChIKey | ISCDMYGHSPIGKX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|