C14H18BrClFNO2 — CID 106764367
N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-dioxan-2-yl)methyl]propan-1-amine (PubChem CID 106764367) has the molecular formula C14H18BrClFNO2 and a molecular weight of 366.66 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-dioxan-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-dioxan-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106764367 |
| Molecular Formula | C14H18BrClFNO2 |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(1,4-dioxan-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Br)c(Cl)c1F)C1COCCO1 |
| InChI | InChI=1S/C14H18BrClFNO2/c1-2-5-18-14(11-8-19-6-7-20-11)9-3-4-10(15)12(16)13(9)17/h3-4,11,14,18H,2,5-8H2,1H3 |
| InChIKey | LVBPTDCEUSROFY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|