C15H20BrClFNO — CID 106764501
N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methyloxolan-3-yl)methyl]propan-1-amine (PubChem CID 106764501) has the molecular formula C15H20BrClFNO and a molecular weight of 364.69 g/mol. Its IUPAC name is N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methyloxolan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methyloxolan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106764501 |
| Molecular Formula | C15H20BrClFNO |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[(4-bromo-3-chloro-2-fluorophenyl)-(2-methyloxolan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Br)c(Cl)c1F)C1CCOC1C |
| InChI | InChI=1S/C15H20BrClFNO/c1-3-7-19-15(10-6-8-20-9(10)2)11-4-5-12(16)13(17)14(11)18/h4-5,9-10,15,19H,3,6-8H2,1-2H3 |
| InChIKey | RWLKNTMHMOXTDR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|