C13H16Cl2FNO2 — CID 54907786
1-(2,4-dichloro-5-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine (PubChem CID 54907786) has the molecular formula C13H16Cl2FNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 54907786 |
| Molecular Formula | C13H16Cl2FNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1COCCO1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2FNO2/c1-8(17-6-9-7-18-2-3-19-9)10-4-13(16)12(15)5-11(10)14/h4-5,8-9,17H,2-3,6-7H2,1H3 |
| InChIKey | RPEZKFVYMQPZDJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|