C15H23NO4 — CID 61023281
1-(2,5-dimethoxyphenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine (PubChem CID 61023281) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 61023281 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
| SMILES | COc1ccc(OC)c(C(C)NCC2COCCO2)c1 |
| InChI | InChI=1S/C15H23NO4/c1-11(16-9-13-10-19-6-7-20-13)14-8-12(17-2)4-5-15(14)18-3/h4-5,8,11,13,16H,6-7,9-10H2,1-3H3 |
| InChIKey | NSQXCMWDMWEPCU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |