C13H17BrFNO2 — CID 113260327
1-(2-bromo-4-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine (PubChem CID 113260327) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 113260327 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-(1,4-dioxan-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1COCCO1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H17BrFNO2/c1-9(12-3-2-10(15)6-13(12)14)16-7-11-8-17-4-5-18-11/h2-3,6,9,11,16H,4-5,7-8H2,1H3 |
| InChIKey | HTYNDMGAUKOLBV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |