C16H25NO4 — CID 81134000
4-[[1-(2,5-dimethoxyphenyl)ethylamino]methyl]oxan-4-ol (PubChem CID 81134000) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethoxyphenyl)ethylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[1-(2,5-dimethoxyphenyl)ethylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81134000 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-[[1-(2,5-dimethoxyphenyl)ethylamino]methyl]oxan-4-ol |
| SMILES | COc1ccc(OC)c(C(C)NCC2(O)CCOCC2)c1 |
| InChI | InChI=1S/C16H25NO4/c1-12(17-11-16(18)6-8-21-9-7-16)14-10-13(19-2)4-5-15(14)20-3/h4-5,10,12,17-18H,6-9,11H2,1-3H3 |
| InChIKey | OFNRTZNCFFWWRX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |