C16H25NO2 — CID 81131119
4-[[1-(2,5-dimethylphenyl)ethylamino]methyl]oxan-4-ol (PubChem CID 81131119) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethylphenyl)ethylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[1-(2,5-dimethylphenyl)ethylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81131119 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 4-[[1-(2,5-dimethylphenyl)ethylamino]methyl]oxan-4-ol |
| SMILES | Cc1ccc(C)c(C(C)NCC2(O)CCOCC2)c1 |
| InChI | InChI=1S/C16H25NO2/c1-12-4-5-13(2)15(10-12)14(3)17-11-16(18)6-8-19-9-7-16/h4-5,10,14,17-18H,6-9,11H2,1-3H3 |
| InChIKey | MLLMIIVCQWRXFH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |