C18H29NO2 — CID 65115152
2-[1-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethyl]-4-methylphenol (PubChem CID 65115152) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[1-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethyl]-4-methylphenol.
| Compound Name | 2-[1-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethyl]-4-methylphenol |
|---|---|
| PubChem CID | 65115152 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-[1-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]ethyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(C(C)NCC2(O)CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C18H29NO2/c1-13-5-6-16(20)15(11-13)14(2)19-12-18(21)9-7-17(3,4)8-10-18/h5-6,11,14,19-21H,7-10,12H2,1-4H3 |
| InChIKey | LNIYLOIMUMWYAH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|