C14H21NOS — CID 107270122
4-methyl-2-[1-[(1-methylsulfanylcyclopropyl)methylamino]ethyl]phenol (PubChem CID 107270122) has the molecular formula C14H21NOS and a molecular weight of 251.40 g/mol. Its IUPAC name is 4-methyl-2-[1-[(1-methylsulfanylcyclopropyl)methylamino]ethyl]phenol.
| Compound Name | 4-methyl-2-[1-[(1-methylsulfanylcyclopropyl)methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 107270122 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-methyl-2-[1-[(1-methylsulfanylcyclopropyl)methylamino]ethyl]phenol |
| SMILES | CSC1(CNC(C)c2cc(C)ccc2O)CC1 |
| InChI | InChI=1S/C14H21NOS/c1-10-4-5-13(16)12(8-10)11(2)15-9-14(17-3)6-7-14/h4-5,8,11,15-16H,6-7,9H2,1-3H3 |
| InChIKey | KNONXJBDGOKVRS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|