C16H23NO2 — CID 103903654
N-[1-(2,5-dimethoxyphenyl)ethyl]hex-5-yn-1-amine (PubChem CID 103903654) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]hex-5-yn-1-amine.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 103903654 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNC(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H23NO2/c1-5-6-7-8-11-17-13(2)15-12-14(18-3)9-10-16(15)19-4/h1,9-10,12-13,17H,6-8,11H2,2-4H3 |
| InChIKey | VVFZRXQKQDTCBL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|