C13H18N2O2 — CID 43207694
3-[1-(2,4-dimethoxyphenyl)ethylamino]propanenitrile (PubChem CID 43207694) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[1-(2,4-dimethoxyphenyl)ethylamino]propanenitrile.
| Compound Name | 3-[1-(2,4-dimethoxyphenyl)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 43207694 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[1-(2,4-dimethoxyphenyl)ethylamino]propanenitrile |
| SMILES | COc1ccc(C(C)NCCC#N)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-10(15-8-4-7-14)12-6-5-11(16-2)9-13(12)17-3/h5-6,9-10,15H,4,8H2,1-3H3 |
| InChIKey | ADYAOPAWERKLPY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|