C12H16N2O — CID 43183181
3-[1-(2-methoxyphenyl)ethylamino]propanenitrile (PubChem CID 43183181) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[1-(2-methoxyphenyl)ethylamino]propanenitrile.
| Compound Name | 3-[1-(2-methoxyphenyl)ethylamino]propanenitrile |
|---|---|
| PubChem CID | 43183181 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-[1-(2-methoxyphenyl)ethylamino]propanenitrile |
| SMILES | COc1ccccc1C(C)NCCC#N |
| InChI | InChI=1S/C12H16N2O/c1-10(14-9-5-8-13)11-6-3-4-7-12(11)15-2/h3-4,6-7,10,14H,5,9H2,1-2H3 |
| InChIKey | FZCLPDILZVYDBT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|