C15H23NO2 — CID 113348558
(E)-N-[1-(2,4-dimethoxyphenyl)ethyl]pent-3-en-1-amine (PubChem CID 113348558) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (E)-N-[1-(2,4-dimethoxyphenyl)ethyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[1-(2,4-dimethoxyphenyl)ethyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 113348558 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (E)-N-[1-(2,4-dimethoxyphenyl)ethyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNC(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H23NO2/c1-5-6-7-10-16-12(2)14-9-8-13(17-3)11-15(14)18-4/h5-6,8-9,11-12,16H,7,10H2,1-4H3/b6-5+ |
| InChIKey | HLTYIIPCXGHEFY-AATRIKPKSA-N |
| XLogP | 3.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|