C14H19NO2 — CID 115896882
N-[1-(2,4-dimethoxyphenyl)ethyl]but-2-yn-1-amine (PubChem CID 115896882) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]but-2-yn-1-amine.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 115896882 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]but-2-yn-1-amine |
| SMILES | CC#CCNC(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H19NO2/c1-5-6-9-15-11(2)13-8-7-12(16-3)10-14(13)17-4/h7-8,10-11,15H,9H2,1-4H3 |
| InChIKey | AXTWBUBGSUNAAJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|