C15H25N3O3 — CID 83112283
3-[2-[1-(2,5-dimethoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea (PubChem CID 83112283) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-[2-[1-(2,5-dimethoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[1-(2,5-dimethoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83112283 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 3-[2-[1-(2,5-dimethoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea |
| SMILES | COc1ccc(OC)c(C(C)NCCNC(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H25N3O3/c1-11(16-8-9-17-15(19)18(2)3)13-10-12(20-4)6-7-14(13)21-5/h6-7,10-11,16H,8-9H2,1-5H3,(H,17,19) |
| InChIKey | LFXWDKPAOPMAFT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|