C16H23NO3 — CID 106211873
1-(2,5-dimethoxyphenyl)-2-(hex-5-ynylamino)ethanol (PubChem CID 106211873) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(hex-5-ynylamino)ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(hex-5-ynylamino)ethanol |
|---|---|
| PubChem CID | 106211873 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(hex-5-ynylamino)ethanol |
| SMILES | C#CCCCCNCC(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H23NO3/c1-4-5-6-7-10-17-12-15(18)14-11-13(19-2)8-9-16(14)20-3/h1,8-9,11,15,17-18H,5-7,10,12H2,2-3H3 |
| InChIKey | UVDOTKZIEKWYME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|