C13H17NO2 — CID 115871890
2,4-dimethoxy-N-pent-4-ynylaniline (PubChem CID 115871890) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2,4-dimethoxy-N-pent-4-ynylaniline.
| Compound Name | 2,4-dimethoxy-N-pent-4-ynylaniline |
|---|---|
| PubChem CID | 115871890 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,4-dimethoxy-N-pent-4-ynylaniline |
| SMILES | C#CCCCNc1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H17NO2/c1-4-5-6-9-14-12-8-7-11(15-2)10-13(12)16-3/h1,7-8,10,14H,5-6,9H2,2-3H3 |
| InChIKey | PUAMCASWAAJKJW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|