C13H22N2O2 — CID 82084110
N-(2,4-dimethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 82084110) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(2,4-dimethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82084110 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(NCCCN(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H22N2O2/c1-15(2)9-5-8-14-12-7-6-11(16-3)10-13(12)17-4/h6-7,10,14H,5,8-9H2,1-4H3 |
| InChIKey | JGIYSSAQMLHWSA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|