C15H25N3O3 — CID 58817803
1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 58817803) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 58817803 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | COc1ccc(CNC(=O)NCCCN(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H25N3O3/c1-18(2)9-5-8-16-15(19)17-11-12-6-7-13(20-3)10-14(12)21-4/h6-7,10H,5,8-9,11H2,1-4H3,(H2,16,17,19) |
| InChIKey | WETYNAPDLMCIKB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|