C10H14N2O3 — CID 53362457
(2,4-dimethoxyphenyl)methylurea (PubChem CID 53362457) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methylurea.
| Compound Name | (2,4-dimethoxyphenyl)methylurea |
|---|---|
| PubChem CID | 53362457 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2,4-dimethoxyphenyl)methylurea |
| SMILES | COc1ccc(CNC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C10H14N2O3/c1-14-8-4-3-7(6-12-10(11)13)9(5-8)15-2/h3-5H,6H2,1-2H3,(H3,11,12,13) |
| InChIKey | HNAHGDZAQREPAU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |