C12H17N3O4 — CID 60977202
N-carbamoyl-2-[(2,4-dimethoxyphenyl)methylamino]acetamide (PubChem CID 60977202) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is N-carbamoyl-2-[(2,4-dimethoxyphenyl)methylamino]acetamide.
| Compound Name | N-carbamoyl-2-[(2,4-dimethoxyphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 60977202 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-carbamoyl-2-[(2,4-dimethoxyphenyl)methylamino]acetamide |
| SMILES | COc1ccc(CNCC(=O)NC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-18-9-4-3-8(10(5-9)19-2)6-14-7-11(16)15-12(13)17/h3-5,14H,6-7H2,1-2H3,(H3,13,15,16,17) |
| InChIKey | XDJAPZHFYSZLGU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |