C11H15N3O4 — CID 28570489
N-carbamoyl-2-(2,4-dimethoxyanilino)acetamide (PubChem CID 28570489) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-carbamoyl-2-(2,4-dimethoxyanilino)acetamide.
| Compound Name | N-carbamoyl-2-(2,4-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 28570489 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-carbamoyl-2-(2,4-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)NC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C11H15N3O4/c1-17-7-3-4-8(9(5-7)18-2)13-6-10(15)14-11(12)16/h3-5,13H,6H2,1-2H3,(H3,12,14,15,16) |
| InChIKey | BKBXKEVWEPLJRI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|