C15H22N2O4 — CID 60976756
2-[(2,4-dimethoxyphenyl)methylamino]-1-morpholin-4-ylethanone (PubChem CID 60976756) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methylamino]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methylamino]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 60976756 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methylamino]-1-morpholin-4-ylethanone |
| SMILES | COc1ccc(CNCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-19-13-4-3-12(14(9-13)20-2)10-16-11-15(18)17-5-7-21-8-6-17/h3-4,9,16H,5-8,10-11H2,1-2H3 |
| InChIKey | XUJUVHZPQSTDCJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |