C14H25NO5 — CID 170597186
2-[(2,4-dimethoxyphenyl)methylamino]acetic acid;ethane;methanol (PubChem CID 170597186) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methylamino]acetic acid;ethane;methanol.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methylamino]acetic acid;ethane;methanol |
|---|---|
| PubChem CID | 170597186 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methylamino]acetic acid;ethane;methanol |
| SMILES | CC.CO.COc1ccc(CNCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C11H15NO4.C2H6.CH4O/c1-15-9-4-3-8(10(5-9)16-2)6-12-7-11(13)14;2*1-2/h3-5,12H,6-7H2,1-2H3,(H,13,14);1-2H3;2H,1H3 |
| InChIKey | KECXKEARMARXTN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |