C19H24N2O3 — CID 6492077
N-[(2,4-dimethoxyphenyl)methyl]-4-morpholin-4-ylaniline (PubChem CID 6492077) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 6492077 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-morpholin-4-ylaniline |
| SMILES | COc1ccc(CNc2ccc(N3CCOCC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-22-18-8-3-15(19(13-18)23-2)14-20-16-4-6-17(7-5-16)21-9-11-24-12-10-21/h3-8,13,20H,9-12,14H2,1-2H3 |
| InChIKey | AVKSMYBMDQWLOW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|